C22H36O2 — CID 10544590
methyl (5E,9E,13E)-5,9,13-trimethyloctadeca-5,9,13,17-tetraenoate (PubChem CID 10544590) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is methyl (5E,9E,13E)-5,9,13-trimethyloctadeca-5,9,13,17-tetraenoate.
| Compound Name | methyl (5E,9E,13E)-5,9,13-trimethyloctadeca-5,9,13,17-tetraenoate |
|---|---|
| PubChem CID | 10544590 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | methyl (5E,9E,13E)-5,9,13-trimethyloctadeca-5,9,13,17-tetraenoate |
| SMILES | C=CCC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCC(=O)OC |
| InChI | InChI=1S/C22H36O2/c1-6-7-8-12-19(2)13-9-14-20(3)15-10-16-21(4)17-11-18-22(23)24-5/h6,12,14,16H,1,7-11,13,15,17-18H2,2-5H3/b19-12+,20-14+,21-16+ |
| InChIKey | VUPGGBKTFQCJSE-RFRQLJORSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|