C26H44O2 — CID 121282254
methyl (9E,12E,16E)-13,17,21-trimethyldocosa-9,12,16,20-tetraenoate (PubChem CID 121282254) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is methyl (9E,12E,16E)-13,17,21-trimethyldocosa-9,12,16,20-tetraenoate.
| Compound Name | methyl (9E,12E,16E)-13,17,21-trimethyldocosa-9,12,16,20-tetraenoate |
|---|---|
| PubChem CID | 121282254 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | methyl (9E,12E,16E)-13,17,21-trimethyldocosa-9,12,16,20-tetraenoate |
| SMILES | COC(=O)CCCCCCC/C=C/C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H44O2/c1-23(2)17-15-19-25(4)21-16-20-24(3)18-13-11-9-7-6-8-10-12-14-22-26(27)28-5/h9,11,17-18,21H,6-8,10,12-16,19-20,22H2,1-5H3/b11-9+,24-18+,25-21+ |
| InChIKey | LRQPRVRGOYCONH-SQLRDQBKSA-N |
| XLogP | 8.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|