C17H30O3 — CID 101177458
methyl (9E,12E)-15-hydroxy-12-methylpentadeca-9,12-dienoate (PubChem CID 101177458) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is methyl (9E,12E)-15-hydroxy-12-methylpentadeca-9,12-dienoate.
| Compound Name | methyl (9E,12E)-15-hydroxy-12-methylpentadeca-9,12-dienoate |
|---|---|
| PubChem CID | 101177458 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | methyl (9E,12E)-15-hydroxy-12-methylpentadeca-9,12-dienoate |
| SMILES | COC(=O)CCCCCCC/C=C/C/C(C)=C/CCO |
| InChI | InChI=1S/C17H30O3/c1-16(13-11-15-18)12-9-7-5-3-4-6-8-10-14-17(19)20-2/h7,9,13,18H,3-6,8,10-12,14-15H2,1-2H3/b9-7+,16-13+ |
| InChIKey | AUPCYCXYDXUCBQ-UJZPVOFNSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|