C38H66O2 — CID 11421537
[(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] (Z)-octadec-9-enoate (PubChem CID 11421537) has the molecular formula C38H66O2 and a molecular weight of 554.94 g/mol. Its IUPAC name is [(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] (Z)-octadec-9-enoate.
| Compound Name | [(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 11421537 |
| Molecular Formula | C38H66O2 |
| Molecular Weight | 554.94 g/mol |
| Exact Mass | 554.51 |
| IUPAC Name | [(2E,6Z,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC/C=C(\C)CC/C=C(/C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C38H66O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31-38(39)40-33-32-37(6)30-24-29-36(5)28-23-27-35(4)26-22-25-34(2)3/h14-15,25,27,29,32H,7-13,16-24,26,28,30-31,33H2,1-6H3/b15-14-,35-27+,36-29-,37-32+ |
| InChIKey | YNODMAKSKVTFCK-FKCVARJISA-N |
| XLogP | 12.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.94 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|