C24H40O4 — CID 118506626
1-O-pentyl 4-O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] butanedioate (PubChem CID 118506626) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 1-O-pentyl 4-O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] butanedioate.
| Compound Name | 1-O-pentyl 4-O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] butanedioate |
|---|---|
| PubChem CID | 118506626 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1-O-pentyl 4-O-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] butanedioate |
| SMILES | CCCCCOC(=O)CCC(=O)OC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H40O4/c1-6-7-8-18-27-23(25)15-16-24(26)28-19-17-22(5)14-10-13-21(4)12-9-11-20(2)3/h11,13,17H,6-10,12,14-16,18-19H2,1-5H3/b21-13+,22-17+ |
| InChIKey | RKFSFJBMFPBGCU-BRAPJGFWSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|