About dimethyl pentanedioate;hydrochloride
dimethyl pentanedioate;hydrochloride (PubChem CID 175168861) has the molecular formula C7H13ClO4
and a molecular weight of 196.63 g/mol. Its IUPAC name is dimethyl pentanedioate;hydrochloride.
Molecular Properties
| Compound Name | dimethyl pentanedioate;hydrochloride |
| PubChem CID | 175168861 |
| Molecular Formula | C7H13ClO4 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | dimethyl pentanedioate;hydrochloride |
| SMILES | COC(=O)CCCC(=O)OC.Cl |
| InChI | InChI=1S/C7H12O4.ClH/c1-10-6(8)4-3-5-7(9)11-2;/h3-5H2,1-2H3;1H |
| InChIKey | IQSUEUKQTLDXLH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl pentanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl pentanedioate;hydrochloride?
The IUPAC name of dimethyl pentanedioate;hydrochloride (CID 175168861) is dimethyl pentanedioate;hydrochloride.
What is the SMILES notation for dimethyl pentanedioate;hydrochloride?
The canonical SMILES for dimethyl pentanedioate;hydrochloride is COC(=O)CCCC(=O)OC.Cl.
What is the InChIKey of dimethyl pentanedioate;hydrochloride?
The InChIKey is IQSUEUKQTLDXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.ClH/c1-10-6(8)4-3-5-7(9)11-2;/h3-5H2,1-2H3;1H.
What are the key properties of dimethyl pentanedioate;hydrochloride?
dimethyl pentanedioate;hydrochloride has a molecular weight of 196.63 g/mol, XLogP of 0.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl pentanedioate;hydrochloride is sourced from PubChem (CID 175168861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).