About methyl 4-aminobutanoate;dihydrochloride
methyl 4-aminobutanoate;dihydrochloride (PubChem CID 170991800) has the molecular formula C5H13Cl2NO2
and a molecular weight of 190.07 g/mol. Its IUPAC name is methyl 4-aminobutanoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 4-aminobutanoate;dihydrochloride |
| PubChem CID | 170991800 |
| Molecular Formula | C5H13Cl2NO2 |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | methyl 4-aminobutanoate;dihydrochloride |
| SMILES | COC(=O)CCCN.Cl.Cl |
| InChI | InChI=1S/C5H11NO2.2ClH/c1-8-5(7)3-2-4-6;;/h2-4,6H2,1H3;2*1H |
| InChIKey | NMAQGFXECPTYAA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-aminobutanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-aminobutanoate;dihydrochloride?
The IUPAC name of methyl 4-aminobutanoate;dihydrochloride (CID 170991800) is methyl 4-aminobutanoate;dihydrochloride.
What is the SMILES notation for methyl 4-aminobutanoate;dihydrochloride?
The canonical SMILES for methyl 4-aminobutanoate;dihydrochloride is COC(=O)CCCN.Cl.Cl.
What is the InChIKey of methyl 4-aminobutanoate;dihydrochloride?
The InChIKey is NMAQGFXECPTYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.2ClH/c1-8-5(7)3-2-4-6;;/h2-4,6H2,1H3;2*1H.
What are the key properties of methyl 4-aminobutanoate;dihydrochloride?
methyl 4-aminobutanoate;dihydrochloride has a molecular weight of 190.07 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-aminobutanoate;dihydrochloride is sourced from PubChem (CID 170991800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).