About methyl 11-aminoundecanoate;hydrochloride
methyl 11-aminoundecanoate;hydrochloride (PubChem CID 12720706) has the molecular formula C12H26ClNO2
and a molecular weight of 251.80 g/mol. Its IUPAC name is methyl 11-aminoundecanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 11-aminoundecanoate;hydrochloride |
| PubChem CID | 12720706 |
| Molecular Formula | C12H26ClNO2 |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | methyl 11-aminoundecanoate;hydrochloride |
| SMILES | COC(=O)CCCCCCCCCCN.Cl |
| InChI | InChI=1S/C12H25NO2.ClH/c1-15-12(14)10-8-6-4-2-3-5-7-9-11-13;/h2-11,13H2,1H3;1H |
| InChIKey | IWHIKEQZPPYMOH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 11-aminoundecanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 11-aminoundecanoate;hydrochloride?
The IUPAC name of methyl 11-aminoundecanoate;hydrochloride (CID 12720706) is methyl 11-aminoundecanoate;hydrochloride.
What is the SMILES notation for methyl 11-aminoundecanoate;hydrochloride?
The canonical SMILES for methyl 11-aminoundecanoate;hydrochloride is COC(=O)CCCCCCCCCCN.Cl.
What is the InChIKey of methyl 11-aminoundecanoate;hydrochloride?
The InChIKey is IWHIKEQZPPYMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2.ClH/c1-15-12(14)10-8-6-4-2-3-5-7-9-11-13;/h2-11,13H2,1H3;1H.
What are the key properties of methyl 11-aminoundecanoate;hydrochloride?
methyl 11-aminoundecanoate;hydrochloride has a molecular weight of 251.80 g/mol, XLogP of 3.05, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 11-aminoundecanoate;hydrochloride is sourced from PubChem (CID 12720706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).