C23H44O2 — CID 24840684
methyl (E,9R,13R)-5,9,13,17-tetramethyloctadec-4-enoate (PubChem CID 24840684) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is methyl (E,9R,13R)-5,9,13,17-tetramethyloctadec-4-enoate.
| Compound Name | methyl (E,9R,13R)-5,9,13,17-tetramethyloctadec-4-enoate |
|---|---|
| PubChem CID | 24840684 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | methyl (E,9R,13R)-5,9,13,17-tetramethyloctadec-4-enoate |
| SMILES | COC(=O)CC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C23H44O2/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(24)25-6/h17,19-21H,7-16,18H2,1-6H3/b22-17+/t20-,21-/m1/s1 |
| InChIKey | RJEGIONMTWNNPG-DVRMEFSISA-N |
| XLogP | 7.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|