C19H36O4 — CID 88939235
2,3-dihydroxypropyl (E)-4,8,12-trimethyltridec-3-enoate (PubChem CID 88939235) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (E)-4,8,12-trimethyltridec-3-enoate.
| Compound Name | 2,3-dihydroxypropyl (E)-4,8,12-trimethyltridec-3-enoate |
|---|---|
| PubChem CID | 88939235 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 2,3-dihydroxypropyl (E)-4,8,12-trimethyltridec-3-enoate |
| SMILES | C/C(=C\CC(=O)OCC(O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C19H36O4/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-19(22)23-14-18(21)13-20/h11,15-16,18,20-21H,5-10,12-14H2,1-4H3/b17-11+ |
| InChIKey | JMWMKDORLZIVQO-GZTJUZNOSA-N |
| XLogP | 3.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|