C20H38O5 — CID 141302471
[(2S,3R)-2,3,4-trihydroxybutyl] 4,8,12-trimethyltridec-3-enoate (PubChem CID 141302471) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is [(2S,3R)-2,3,4-trihydroxybutyl] 4,8,12-trimethyltridec-3-enoate.
| Compound Name | [(2S,3R)-2,3,4-trihydroxybutyl] 4,8,12-trimethyltridec-3-enoate |
|---|---|
| PubChem CID | 141302471 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | [(2S,3R)-2,3,4-trihydroxybutyl] 4,8,12-trimethyltridec-3-enoate |
| SMILES | CC(=CCC(=O)OC[C@H](O)[C@H](O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O5/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-20(24)25-14-19(23)18(22)13-21/h11,15-16,18-19,21-23H,5-10,12-14H2,1-4H3/t16?,18-,19+/m1/s1 |
| InChIKey | KIULHYFEXQIXKM-VITQDTLGSA-N |
| XLogP | 3.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|