C26H52O5 — CID 175351730
1,3,4-trihydroxybutan-2-yl 5,9,13,17-tetramethyloctadecanoate (PubChem CID 175351730) has the molecular formula C26H52O5 and a molecular weight of 444.70 g/mol. Its IUPAC name is 1,3,4-trihydroxybutan-2-yl 5,9,13,17-tetramethyloctadecanoate.
| Compound Name | 1,3,4-trihydroxybutan-2-yl 5,9,13,17-tetramethyloctadecanoate |
|---|---|
| PubChem CID | 175351730 |
| Molecular Formula | C26H52O5 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | 1,3,4-trihydroxybutan-2-yl 5,9,13,17-tetramethyloctadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(=O)OC(CO)C(O)CO |
| InChI | InChI=1S/C26H52O5/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-9-17-26(30)31-25(19-28)24(29)18-27/h20-25,27-29H,6-19H2,1-5H3 |
| InChIKey | XBDLDWGMVFNGAF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |