C26H50O7 — CID 123691187
[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3,7,11,15-tetramethylhexadec-2-enoate (PubChem CID 123691187) has the molecular formula C26H50O7 and a molecular weight of 474.68 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3,7,11,15-tetramethylhexadec-2-enoate.
| Compound Name | [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3,7,11,15-tetramethylhexadec-2-enoate |
|---|---|
| PubChem CID | 123691187 |
| Molecular Formula | C26H50O7 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3,7,11,15-tetramethylhexadec-2-enoate |
| SMILES | CC(=CC(=O)OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H50O7/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-24(30)33-17-23(29)26(32)25(31)22(28)16-27/h15,18-20,22-23,25-29,31-32H,6-14,16-17H2,1-5H3/t19?,20?,22-,23-,25-,26-/m0/s1 |
| InChIKey | XSEQXFFCPOCVNE-WQCRKWPDSA-N |
| XLogP | 3.35 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|