C26H52O5 — CID 175807272
(2R,3R)-1,2,3,4-tetrahydroxy-9,13,17,21-tetramethyldocosan-5-one (PubChem CID 175807272) has the molecular formula C26H52O5 and a molecular weight of 444.70 g/mol. Its IUPAC name is (2R,3R)-1,2,3,4-tetrahydroxy-9,13,17,21-tetramethyldocosan-5-one.
| Compound Name | (2R,3R)-1,2,3,4-tetrahydroxy-9,13,17,21-tetramethyldocosan-5-one |
|---|---|
| PubChem CID | 175807272 |
| Molecular Formula | C26H52O5 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | (2R,3R)-1,2,3,4-tetrahydroxy-9,13,17,21-tetramethyldocosan-5-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(=O)C(O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C26H52O5/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-15-22(5)16-9-17-23(28)25(30)26(31)24(29)18-27/h19-22,24-27,29-31H,6-18H2,1-5H3/t20?,21?,22?,24-,25?,26-/m1/s1 |
| InChIKey | BLSYRKMTJXGMIH-YEMQUZTISA-N |
| XLogP | 4.88 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |