C19H40O — CID 161345057
2,6-dimethylheptane;2,7-dimethyloctan-3-one (PubChem CID 161345057) has the molecular formula C19H40O and a molecular weight of 284.53 g/mol. Its IUPAC name is 2,6-dimethylheptane;2,7-dimethyloctan-3-one.
| Compound Name | 2,6-dimethylheptane;2,7-dimethyloctan-3-one |
|---|---|
| PubChem CID | 161345057 |
| Molecular Formula | C19H40O |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.31 |
| IUPAC Name | 2,6-dimethylheptane;2,7-dimethyloctan-3-one |
| SMILES | CC(C)CCCC(=O)C(C)C.CC(C)CCCC(C)C |
| InChI | InChI=1S/C10H20O.C9H20/c1-8(2)6-5-7-10(11)9(3)4;1-8(2)6-5-7-9(3)4/h8-9H,5-7H2,1-4H3;8-9H,5-7H2,1-4H3 |
| InChIKey | VNEJKDWGKFWZJU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |