About 2,6-dimethylheptane;2,7-dimethyloctan-3-one
2,6-dimethylheptane;2,7-dimethyloctan-3-one (PubChem CID 161345057) has the molecular formula C19H40O
and a molecular weight of 284.53 g/mol. Its IUPAC name is 2,6-dimethylheptane;2,7-dimethyloctan-3-one.
Molecular Properties
| Compound Name | 2,6-dimethylheptane;2,7-dimethyloctan-3-one |
| PubChem CID | 161345057 |
| Molecular Formula | C19H40O |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.31 |
| IUPAC Name | 2,6-dimethylheptane;2,7-dimethyloctan-3-one |
| SMILES | CC(C)CCCC(=O)C(C)C.CC(C)CCCC(C)C |
| InChI | InChI=1S/C10H20O.C9H20/c1-8(2)6-5-7-10(11)9(3)4;1-8(2)6-5-7-9(3)4/h8-9H,5-7H2,1-4H3;8-9H,5-7H2,1-4H3 |
| InChIKey | VNEJKDWGKFWZJU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethylheptane;2,7-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptane;2,7-dimethyloctan-3-one?
The IUPAC name of 2,6-dimethylheptane;2,7-dimethyloctan-3-one (CID 161345057) is 2,6-dimethylheptane;2,7-dimethyloctan-3-one.
What is the SMILES notation for 2,6-dimethylheptane;2,7-dimethyloctan-3-one?
The canonical SMILES for 2,6-dimethylheptane;2,7-dimethyloctan-3-one is CC(C)CCCC(=O)C(C)C.CC(C)CCCC(C)C.
What is the InChIKey of 2,6-dimethylheptane;2,7-dimethyloctan-3-one?
The InChIKey is VNEJKDWGKFWZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C9H20/c1-8(2)6-5-7-10(11)9(3)4;1-8(2)6-5-7-9(3)4/h8-9H,5-7H2,1-4H3;8-9H,5-7H2,1-4H3.
What are the key properties of 2,6-dimethylheptane;2,7-dimethyloctan-3-one?
2,6-dimethylheptane;2,7-dimethyloctan-3-one has a molecular weight of 284.53 g/mol, XLogP of 6.51, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptane;2,7-dimethyloctan-3-one is sourced from PubChem (CID 161345057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).