C11H23NO — CID 116586892
2,7-dimethyl-1-(methylamino)octan-3-one (PubChem CID 116586892) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2,7-dimethyl-1-(methylamino)octan-3-one.
| Compound Name | 2,7-dimethyl-1-(methylamino)octan-3-one |
|---|---|
| PubChem CID | 116586892 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2,7-dimethyl-1-(methylamino)octan-3-one |
| SMILES | CNCC(C)C(=O)CCCC(C)C |
| InChI | InChI=1S/C11H23NO/c1-9(2)6-5-7-11(13)10(3)8-12-4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | MGZUSVACZWENIQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |