C8H18N2O — CID 116846298
N',5-dimethylhexanehydrazide (PubChem CID 116846298) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is N',5-dimethylhexanehydrazide.
| Compound Name | N',5-dimethylhexanehydrazide |
|---|---|
| PubChem CID | 116846298 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N',5-dimethylhexanehydrazide |
| SMILES | CNNC(=O)CCCC(C)C |
| InChI | InChI=1S/C8H18N2O/c1-7(2)5-4-6-8(11)10-9-3/h7,9H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | WJPRLSFQSUUSJN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|