C11H23NO — CID 116594924
1-amino-3,8-dimethylnonan-4-one (PubChem CID 116594924) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-amino-3,8-dimethylnonan-4-one.
| Compound Name | 1-amino-3,8-dimethylnonan-4-one |
|---|---|
| PubChem CID | 116594924 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-amino-3,8-dimethylnonan-4-one |
| SMILES | CC(C)CCCC(=O)C(C)CCN |
| InChI | InChI=1S/C11H23NO/c1-9(2)5-4-6-11(13)10(3)7-8-12/h9-10H,4-8,12H2,1-3H3 |
| InChIKey | IWGGWMUDLZEXSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |