C15H29NO2 — CID 171600874
8-methyl-1-(3-methylbutylamino)nonane-3,7-dione (PubChem CID 171600874) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 8-methyl-1-(3-methylbutylamino)nonane-3,7-dione.
| Compound Name | 8-methyl-1-(3-methylbutylamino)nonane-3,7-dione |
|---|---|
| PubChem CID | 171600874 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 8-methyl-1-(3-methylbutylamino)nonane-3,7-dione |
| SMILES | CC(C)CCNCCC(=O)CCCC(=O)C(C)C |
| InChI | InChI=1S/C15H29NO2/c1-12(2)8-10-16-11-9-14(17)6-5-7-15(18)13(3)4/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | ZTNAZWOHJNHXHY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|