C25H46O4 — CID 167631647
2,9-dimethyldecane-3,7-dione;2,10-dimethylundecane-4,8-dione (PubChem CID 167631647) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2,9-dimethyldecane-3,7-dione;2,10-dimethylundecane-4,8-dione.
| Compound Name | 2,9-dimethyldecane-3,7-dione;2,10-dimethylundecane-4,8-dione |
|---|---|
| PubChem CID | 167631647 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 2,9-dimethyldecane-3,7-dione;2,10-dimethylundecane-4,8-dione |
| SMILES | CC(C)CC(=O)CCCC(=O)C(C)C.CC(C)CC(=O)CCCC(=O)CC(C)C |
| InChI | InChI=1S/C13H24O2.C12H22O2/c1-10(2)8-12(14)6-5-7-13(15)9-11(3)4;1-9(2)8-11(13)6-5-7-12(14)10(3)4/h10-11H,5-9H2,1-4H3;9-10H,5-8H2,1-4H3 |
| InChIKey | NWSPVEILAKHMIW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |