About 14-methylpentadecane-2,13-dione
14-methylpentadecane-2,13-dione (PubChem CID 88544438) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 14-methylpentadecane-2,13-dione.
Molecular Properties
| Compound Name | 14-methylpentadecane-2,13-dione |
| PubChem CID | 88544438 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 14-methylpentadecane-2,13-dione |
| SMILES | CC(=O)CCCCCCCCCCC(=O)C(C)C |
| InChI | InChI=1S/C16H30O2/c1-14(2)16(18)13-11-9-7-5-4-6-8-10-12-15(3)17/h14H,4-13H2,1-3H3 |
| InChIKey | JGMKEXNSSWQOMD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-methylpentadecane-2,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-methylpentadecane-2,13-dione?
The IUPAC name of 14-methylpentadecane-2,13-dione (CID 88544438) is 14-methylpentadecane-2,13-dione.
What is the SMILES notation for 14-methylpentadecane-2,13-dione?
The canonical SMILES for 14-methylpentadecane-2,13-dione is CC(=O)CCCCCCCCCCC(=O)C(C)C.
What is the InChIKey of 14-methylpentadecane-2,13-dione?
The InChIKey is JGMKEXNSSWQOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-14(2)16(18)13-11-9-7-5-4-6-8-10-12-15(3)17/h14H,4-13H2,1-3H3.
What are the key properties of 14-methylpentadecane-2,13-dione?
14-methylpentadecane-2,13-dione has a molecular weight of 254.41 g/mol, XLogP of 4.70, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-methylpentadecane-2,13-dione is sourced from PubChem (CID 88544438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).