About 9-methyl-8-oxodecanamide
9-methyl-8-oxodecanamide (PubChem CID 168891746) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 9-methyl-8-oxodecanamide.
Molecular Properties
| Compound Name | 9-methyl-8-oxodecanamide |
| PubChem CID | 168891746 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 9-methyl-8-oxodecanamide |
| SMILES | CC(C)C(=O)CCCCCCC(N)=O |
| InChI | InChI=1S/C11H21NO2/c1-9(2)10(13)7-5-3-4-6-8-11(12)14/h9H,3-8H2,1-2H3,(H2,12,14) |
| InChIKey | WNZAFQBJUQHQCX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-8-oxodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-8-oxodecanamide?
The IUPAC name of 9-methyl-8-oxodecanamide (CID 168891746) is 9-methyl-8-oxodecanamide.
What is the SMILES notation for 9-methyl-8-oxodecanamide?
The canonical SMILES for 9-methyl-8-oxodecanamide is CC(C)C(=O)CCCCCCC(N)=O.
What is the InChIKey of 9-methyl-8-oxodecanamide?
The InChIKey is WNZAFQBJUQHQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-9(2)10(13)7-5-3-4-6-8-11(12)14/h9H,3-8H2,1-2H3,(H2,12,14).
What are the key properties of 9-methyl-8-oxodecanamide?
9-methyl-8-oxodecanamide has a molecular weight of 199.29 g/mol, XLogP of 2.04, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-8-oxodecanamide is sourced from PubChem (CID 168891746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).