C14H24O3 — CID 22953560
12-methyltridecane-3,4,11-trione (PubChem CID 22953560) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 12-methyltridecane-3,4,11-trione.
| Compound Name | 12-methyltridecane-3,4,11-trione |
|---|---|
| PubChem CID | 22953560 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 12-methyltridecane-3,4,11-trione |
| SMILES | CCC(=O)C(=O)CCCCCCC(=O)C(C)C |
| InChI | InChI=1S/C14H24O3/c1-4-12(15)14(17)10-8-6-5-7-9-13(16)11(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | XCMNHNAPSONGQU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|