C17H29NO4 — CID 158566536
8-methyl-N-(5-methyl-4-oxohexyl)-2,7-dioxononanamide (PubChem CID 158566536) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 8-methyl-N-(5-methyl-4-oxohexyl)-2,7-dioxononanamide.
| Compound Name | 8-methyl-N-(5-methyl-4-oxohexyl)-2,7-dioxononanamide |
|---|---|
| PubChem CID | 158566536 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 8-methyl-N-(5-methyl-4-oxohexyl)-2,7-dioxononanamide |
| SMILES | CC(C)C(=O)CCCCC(=O)C(=O)NCCCC(=O)C(C)C |
| InChI | InChI=1S/C17H29NO4/c1-12(2)14(19)8-5-6-9-16(21)17(22)18-11-7-10-15(20)13(3)4/h12-13H,5-11H2,1-4H3,(H,18,22) |
| InChIKey | HRNXLSLSOJXENO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|