C22H40O5 — CID 159032756
2-methyl-10-[2-(7-methyl-5-oxooctoxy)ethoxy]decane-3,7-dione (PubChem CID 159032756) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-methyl-10-[2-(7-methyl-5-oxooctoxy)ethoxy]decane-3,7-dione.
| Compound Name | 2-methyl-10-[2-(7-methyl-5-oxooctoxy)ethoxy]decane-3,7-dione |
|---|---|
| PubChem CID | 159032756 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-methyl-10-[2-(7-methyl-5-oxooctoxy)ethoxy]decane-3,7-dione |
| SMILES | CC(C)CC(=O)CCCCOCCOCCCC(=O)CCCC(=O)C(C)C |
| InChI | InChI=1S/C22H40O5/c1-18(2)17-21(24)9-5-6-13-26-15-16-27-14-8-11-20(23)10-7-12-22(25)19(3)4/h18-19H,5-17H2,1-4H3 |
| InChIKey | AXGVNEZPCRZPDQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|