C11H19BrO3 — CID 147170335
1-(5-bromo-4-oxopentoxy)-4-methylpentan-3-one (PubChem CID 147170335) has the molecular formula C11H19BrO3 and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-(5-bromo-4-oxopentoxy)-4-methylpentan-3-one.
| Compound Name | 1-(5-bromo-4-oxopentoxy)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 147170335 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-(5-bromo-4-oxopentoxy)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)CCOCCCC(=O)CBr |
| InChI | InChI=1S/C11H19BrO3/c1-9(2)11(14)5-7-15-6-3-4-10(13)8-12/h9H,3-8H2,1-2H3 |
| InChIKey | BXOYXYDURBVRDV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|