C23H44O6 — CID 157073137
7-methyl-1-[2-[2-[2-(6-methyl-3-oxoheptoxy)ethoxy]ethoxy]ethoxy]octan-4-one (PubChem CID 157073137) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is 7-methyl-1-[2-[2-[2-(6-methyl-3-oxoheptoxy)ethoxy]ethoxy]ethoxy]octan-4-one.
| Compound Name | 7-methyl-1-[2-[2-[2-(6-methyl-3-oxoheptoxy)ethoxy]ethoxy]ethoxy]octan-4-one |
|---|---|
| PubChem CID | 157073137 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 7-methyl-1-[2-[2-[2-(6-methyl-3-oxoheptoxy)ethoxy]ethoxy]ethoxy]octan-4-one |
| SMILES | CC(C)CCC(=O)CCCOCCOCCOCCOCCC(=O)CCC(C)C |
| InChI | InChI=1S/C23H44O6/c1-20(2)7-9-22(24)6-5-12-26-14-16-28-18-19-29-17-15-27-13-11-23(25)10-8-21(3)4/h20-21H,5-19H2,1-4H3 |
| InChIKey | ACQWDSAVHYPCQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|