C14H28O5S — CID 159232604
1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-7-sulfanyloctan-4-one (PubChem CID 159232604) has the molecular formula C14H28O5S and a molecular weight of 308.44 g/mol. Its IUPAC name is 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-7-sulfanyloctan-4-one.
| Compound Name | 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-7-sulfanyloctan-4-one |
|---|---|
| PubChem CID | 159232604 |
| Molecular Formula | C14H28O5S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-7-sulfanyloctan-4-one |
| SMILES | CC(S)CCC(=O)CCCOCCOCCOCCO |
| InChI | InChI=1S/C14H28O5S/c1-13(20)4-5-14(16)3-2-7-17-9-11-19-12-10-18-8-6-15/h13,15,20H,2-12H2,1H3 |
| InChIKey | QQFUTUXCVYISCC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|