C14H28O2 — CID 118441422
4-methyl-1-(6-methylheptoxy)pentan-3-one (PubChem CID 118441422) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-methyl-1-(6-methylheptoxy)pentan-3-one.
| Compound Name | 4-methyl-1-(6-methylheptoxy)pentan-3-one |
|---|---|
| PubChem CID | 118441422 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 4-methyl-1-(6-methylheptoxy)pentan-3-one |
| SMILES | CC(C)CCCCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C14H28O2/c1-12(2)8-6-5-7-10-16-11-9-14(15)13(3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | DOUWLKDMDPEXPM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|