C12H24O3 — CID 103413613
8-(2-methoxyethoxy)-2-methyloctan-3-one (PubChem CID 103413613) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 8-(2-methoxyethoxy)-2-methyloctan-3-one.
| Compound Name | 8-(2-methoxyethoxy)-2-methyloctan-3-one |
|---|---|
| PubChem CID | 103413613 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 8-(2-methoxyethoxy)-2-methyloctan-3-one |
| SMILES | COCCOCCCCCC(=O)C(C)C |
| InChI | InChI=1S/C12H24O3/c1-11(2)12(13)7-5-4-6-8-15-10-9-14-3/h11H,4-10H2,1-3H3 |
| InChIKey | UYGRHEYUSGFDAJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|