C25H50O6 — CID 173483496
(2S,3S,4S,5R)-6-[(E)-2,6,10,14-tetramethylpentadec-1-enoxy]hexane-1,2,3,4,5-pentol (PubChem CID 173483496) has the molecular formula C25H50O6 and a molecular weight of 446.67 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[(E)-2,6,10,14-tetramethylpentadec-1-enoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4S,5R)-6-[(E)-2,6,10,14-tetramethylpentadec-1-enoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 173483496 |
| Molecular Formula | C25H50O6 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (2S,3S,4S,5R)-6-[(E)-2,6,10,14-tetramethylpentadec-1-enoxy]hexane-1,2,3,4,5-pentol |
| SMILES | C/C(=C\OC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H50O6/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)16-31-17-23(28)25(30)24(29)22(27)15-26/h16,18-20,22-30H,6-15,17H2,1-5H3/b21-16+/t19?,20?,22-,23+,24-,25-/m0/s1 |
| InChIKey | KXHLGCBRKODMKM-MMXQPBHMSA-N |
| XLogP | 3.78 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|