C24H48O4 — CID 123911046
(2R,3S)-4-(3,7,11,15-tetramethylhexadec-2-enoxy)butane-1,2,3-triol (PubChem CID 123911046) has the molecular formula C24H48O4 and a molecular weight of 400.64 g/mol. Its IUPAC name is (2R,3S)-4-(3,7,11,15-tetramethylhexadec-2-enoxy)butane-1,2,3-triol.
| Compound Name | (2R,3S)-4-(3,7,11,15-tetramethylhexadec-2-enoxy)butane-1,2,3-triol |
|---|---|
| PubChem CID | 123911046 |
| Molecular Formula | C24H48O4 |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | (2R,3S)-4-(3,7,11,15-tetramethylhexadec-2-enoxy)butane-1,2,3-triol |
| SMILES | CC(=CCOC[C@H](O)[C@H](O)CO)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H48O4/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-16-28-18-24(27)23(26)17-25/h15,19-21,23-27H,6-14,16-18H2,1-5H3/t20?,21?,23-,24+/m1/s1 |
| InChIKey | KEVFCAFDEVMPKZ-CGSZWWBZSA-N |
| XLogP | 5.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|