C43H85O6P — CID 91326910
2,3-bis(3,7,11,15-tetramethylhexadec-2-enoxy)propyl dihydrogen phosphate (PubChem CID 91326910) has the molecular formula C43H85O6P and a molecular weight of 729.12 g/mol. Its IUPAC name is 2,3-bis(3,7,11,15-tetramethylhexadec-2-enoxy)propyl dihydrogen phosphate.
| Compound Name | 2,3-bis(3,7,11,15-tetramethylhexadec-2-enoxy)propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 91326910 |
| Molecular Formula | C43H85O6P |
| Molecular Weight | 729.12 g/mol |
| Exact Mass | 728.61 |
| IUPAC Name | 2,3-bis(3,7,11,15-tetramethylhexadec-2-enoxy)propyl dihydrogen phosphate |
| SMILES | CC(=CCOCC(COP(=O)(O)O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C43H85O6P/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-47-33-43(34-49-50(44,45)46)48-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h29-30,35-40,43H,11-28,31-34H2,1-10H3,(H2,44,45,46) |
| InChIKey | ONSAOYDDMVNAIP-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.12 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|