C43H81O8P — CID 175415375
[3-phosphonooxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enoyl]oxypropyl] (E)-3,7,11,15-tetramethylhexadec-2-enoate (PubChem CID 175415375) has the molecular formula C43H81O8P and a molecular weight of 757.09 g/mol. Its IUPAC name is [3-phosphonooxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enoyl]oxypropyl] (E)-3,7,11,15-tetramethylhexadec-2-enoate.
| Compound Name | [3-phosphonooxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enoyl]oxypropyl] (E)-3,7,11,15-tetramethylhexadec-2-enoate |
|---|---|
| PubChem CID | 175415375 |
| Molecular Formula | C43H81O8P |
| Molecular Weight | 757.09 g/mol |
| Exact Mass | 756.57 |
| IUPAC Name | [3-phosphonooxy-2-[(E)-3,7,11,15-tetramethylhexadec-2-enoyl]oxypropyl] (E)-3,7,11,15-tetramethylhexadec-2-enoate |
| SMILES | C/C(=C\C(=O)OCC(COP(=O)(O)O)OC(=O)/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C43H81O8P/c1-33(2)17-11-19-35(5)21-13-23-37(7)25-15-27-39(9)29-42(44)49-31-41(32-50-52(46,47)48)51-43(45)30-40(10)28-16-26-38(8)24-14-22-36(6)20-12-18-34(3)4/h29-30,33-38,41H,11-28,31-32H2,1-10H3,(H2,46,47,48)/b39-29+,40-30+ |
| InChIKey | LKESCWGVMUKOHL-NXRKLTDKSA-N |
| XLogP | 12.32 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.09 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|