C28H55O8P — CID 131822359
[(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] 10-methyldodecanoate (PubChem CID 131822359) has the molecular formula C28H55O8P and a molecular weight of 550.71 g/mol. Its IUPAC name is [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] 10-methyldodecanoate.
| Compound Name | [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] 10-methyldodecanoate |
|---|---|
| PubChem CID | 131822359 |
| Molecular Formula | C28H55O8P |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | [(2R)-2-(10-methylundecanoyloxy)-3-phosphonooxypropyl] 10-methyldodecanoate |
| SMILES | CCC(C)CCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C28H55O8P/c1-5-25(4)19-15-11-7-9-12-16-20-27(29)34-22-26(23-35-37(31,32)33)36-28(30)21-17-13-8-6-10-14-18-24(2)3/h24-26H,5-23H2,1-4H3,(H2,31,32,33)/t25?,26-/m1/s1 |
| InChIKey | KXXIDRGIKFBJDL-FXDYGKIASA-N |
| XLogP | 7.49 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|