C20H40NaO5P — CID 174886667
sodium;hydride;phosphono (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate (PubChem CID 174886667) has the molecular formula C20H40NaO5P and a molecular weight of 414.50 g/mol. Its IUPAC name is sodium;hydride;phosphono (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate.
| Compound Name | sodium;hydride;phosphono (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate |
|---|---|
| PubChem CID | 174886667 |
| Molecular Formula | C20H40NaO5P |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | sodium;hydride;phosphono (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate |
| SMILES | C/C(=C\C(=O)OP(=O)(O)O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.[H-].[Na+] |
| InChI | InChI=1S/C20H39O5P.Na.H/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)25-26(22,23)24;;/h15-18H,6-14H2,1-5H3,(H2,22,23,24);;/q;+1;-1/b19-15+;;/t17-,18-;;/m1../s1 |
| InChIKey | UKNYUYZNXAOUPY-MVMUQCOPSA-N |
| XLogP | 3.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|