C22H41NO3 — CID 174745007
(2-aminoacetyl) (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate (PubChem CID 174745007) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is (2-aminoacetyl) (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate.
| Compound Name | (2-aminoacetyl) (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate |
|---|---|
| PubChem CID | 174745007 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | (2-aminoacetyl) (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoate |
| SMILES | C/C(=C\C(=O)OC(=O)CN)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C22H41NO3/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-21(24)26-22(25)16-23/h15,17-19H,6-14,16,23H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | GBNQFJMJQKZECP-PYDDKJGSSA-N |
| XLogP | 5.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|