C12H22O2 — CID 87604392
ethyl (E)-3,7-dimethyloct-2-enoate (PubChem CID 87604392) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is ethyl (E)-3,7-dimethyloct-2-enoate.
| Compound Name | ethyl (E)-3,7-dimethyloct-2-enoate |
|---|---|
| PubChem CID | 87604392 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethyl (E)-3,7-dimethyloct-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C12H22O2/c1-5-14-12(13)9-11(4)8-6-7-10(2)3/h9-10H,5-8H2,1-4H3/b11-9+ |
| InChIKey | ZUEFKHXRQLTKCX-PKNBQFBNSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|