C23H47NO — CID 154265391
3-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propan-1-amine (PubChem CID 154265391) has the molecular formula C23H47NO and a molecular weight of 353.64 g/mol. Its IUPAC name is 3-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propan-1-amine.
| Compound Name | 3-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propan-1-amine |
|---|---|
| PubChem CID | 154265391 |
| Molecular Formula | C23H47NO |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.37 |
| IUPAC Name | 3-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propan-1-amine |
| SMILES | CC(=CCOCCCN)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C23H47NO/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-19-25-18-9-17-24/h16,20-22H,6-15,17-19,24H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | SJPMEVZDUVUWBA-FGZHOGPDSA-N |
| XLogP | 6.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|