C22H44O4 — CID 75995745
2-(hydroxymethyl)-2-(5,9,13-trimethyltetradec-4-enoxymethyl)propane-1,3-diol (PubChem CID 75995745) has the molecular formula C22H44O4 and a molecular weight of 372.59 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(5,9,13-trimethyltetradec-4-enoxymethyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(5,9,13-trimethyltetradec-4-enoxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 75995745 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 2-(hydroxymethyl)-2-(5,9,13-trimethyltetradec-4-enoxymethyl)propane-1,3-diol |
| SMILES | CC(=CCCCOCC(CO)(CO)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H44O4/c1-19(2)9-7-11-21(4)13-8-12-20(3)10-5-6-14-26-18-22(15-23,16-24)17-25/h10,19,21,23-25H,5-9,11-18H2,1-4H3 |
| InChIKey | FIJSTHPQPCHJTN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|