C23H46O6 — CID 89051859
(2R,3R,4R,5R)-6-[(E)-5,9,13-trimethyltetradec-4-enoxy]hexane-1,2,3,4,5-pentol (PubChem CID 89051859) has the molecular formula C23H46O6 and a molecular weight of 418.62 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-[(E)-5,9,13-trimethyltetradec-4-enoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-6-[(E)-5,9,13-trimethyltetradec-4-enoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 89051859 |
| Molecular Formula | C23H46O6 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (2R,3R,4R,5R)-6-[(E)-5,9,13-trimethyltetradec-4-enoxy]hexane-1,2,3,4,5-pentol |
| SMILES | C/C(=C\CCCOC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C23H46O6/c1-17(2)9-7-11-19(4)13-8-12-18(3)10-5-6-14-29-16-21(26)23(28)22(27)20(25)15-24/h10,17,19-28H,5-9,11-16H2,1-4H3/b18-10+/t19?,20-,21-,22-,23-/m1/s1 |
| InChIKey | KQGNIWLURVKDBY-PSXIYPBUSA-N |
| XLogP | 2.80 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|