C24H44O6 — CID 122226049
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] (E)-7,11,15-trimethyl-3-oxohexadec-6-enoate (PubChem CID 122226049) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (E)-7,11,15-trimethyl-3-oxohexadec-6-enoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (E)-7,11,15-trimethyl-3-oxohexadec-6-enoate |
|---|---|
| PubChem CID | 122226049 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (E)-7,11,15-trimethyl-3-oxohexadec-6-enoate |
| SMILES | C/C(=C\CCC(=O)CC(=O)OCC(CO)(CO)CO)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H44O6/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-22(28)14-23(29)30-18-24(15-25,16-26)17-27/h12,19-20,25-27H,5-11,13-18H2,1-4H3/b21-12+ |
| InChIKey | WHQZTZDQMHDJBG-CIAFOILYSA-N |
| XLogP | 3.81 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|