C42H80O2 — CID 24840687
[(Z)-3,7,11,15-tetramethylhexadec-2-enyl] (Z)-5,9,13,17-tetramethyloctadec-4-enoate (PubChem CID 24840687) has the molecular formula C42H80O2 and a molecular weight of 617.10 g/mol. Its IUPAC name is [(Z)-3,7,11,15-tetramethylhexadec-2-enyl] (Z)-5,9,13,17-tetramethyloctadec-4-enoate.
| Compound Name | [(Z)-3,7,11,15-tetramethylhexadec-2-enyl] (Z)-5,9,13,17-tetramethyloctadec-4-enoate |
|---|---|
| PubChem CID | 24840687 |
| Molecular Formula | C42H80O2 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.62 |
| IUPAC Name | [(Z)-3,7,11,15-tetramethylhexadec-2-enyl] (Z)-5,9,13,17-tetramethyloctadec-4-enoate |
| SMILES | C/C(=C/CCC(=O)OC/C=C(/C)CCCC(C)CCCC(C)CCCC(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C42H80O2/c1-34(2)18-11-20-36(5)22-13-24-38(7)26-15-27-40(9)30-17-31-42(43)44-33-32-41(10)29-16-28-39(8)25-14-23-37(6)21-12-19-35(3)4/h30,32,34-39H,11-29,31,33H2,1-10H3/b40-30-,41-32- |
| InChIKey | ABARQJARKZPEOX-ATSQNPLFSA-N |
| XLogP | 14.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|