C34H64O3 — CID 158258427
(6E)-8-methoxy-2,6-dimethylnona-2,6-diene;[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate (PubChem CID 158258427) has the molecular formula C34H64O3 and a molecular weight of 520.88 g/mol. Its IUPAC name is (6E)-8-methoxy-2,6-dimethylnona-2,6-diene;[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate.
| Compound Name | (6E)-8-methoxy-2,6-dimethylnona-2,6-diene;[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate |
|---|---|
| PubChem CID | 158258427 |
| Molecular Formula | C34H64O3 |
| Molecular Weight | 520.88 g/mol |
| Exact Mass | 520.49 |
| IUPAC Name | (6E)-8-methoxy-2,6-dimethylnona-2,6-diene;[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.COC(C)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H42O2.C12H22O/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-24-22(6)23;1-10(2)7-6-8-11(3)9-12(4)13-5/h16,18-20H,7-15,17H2,1-6H3;7,9,12H,6,8H2,1-5H3/b21-16+;11-9+/t19-,20-;/m1./s1 |
| InChIKey | GHONPQXXBDMMQT-YGCZCRRMSA-N |
| XLogP | 10.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.88 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|