C25H53NO4P+ — CID 88861900
trimethyl-(5,9,13,17-tetramethyl-2-phosphonooxyoctadec-4-enyl)azanium (PubChem CID 88861900) has the molecular formula C25H53NO4P+ and a molecular weight of 462.68 g/mol. Its IUPAC name is trimethyl-(5,9,13,17-tetramethyl-2-phosphonooxyoctadec-4-enyl)azanium.
| Compound Name | trimethyl-(5,9,13,17-tetramethyl-2-phosphonooxyoctadec-4-enyl)azanium |
|---|---|
| PubChem CID | 88861900 |
| Molecular Formula | C25H53NO4P+ |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | trimethyl-(5,9,13,17-tetramethyl-2-phosphonooxyoctadec-4-enyl)azanium |
| SMILES | CC(=CCC(C[N+](C)(C)C)OP(=O)(O)O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H52NO4P/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-17-24(5)18-19-25(20-26(6,7)8)30-31(27,28)29/h18,21-23,25H,9-17,19-20H2,1-8H3,(H-,27,28,29)/p+1 |
| InChIKey | IMINOCIUNQRHHN-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|