C23H42O3 — CID 129137162
(2S)-6,10,14,18-tetramethylnonadeca-5,7,9-triene-1,2,3-triol (PubChem CID 129137162) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is (2S)-6,10,14,18-tetramethylnonadeca-5,7,9-triene-1,2,3-triol.
| Compound Name | (2S)-6,10,14,18-tetramethylnonadeca-5,7,9-triene-1,2,3-triol |
|---|---|
| PubChem CID | 129137162 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | (2S)-6,10,14,18-tetramethylnonadeca-5,7,9-triene-1,2,3-triol |
| SMILES | CC(C=CC=C(C)CCCC(C)CCCC(C)C)=CCC(O)[C@@H](O)CO |
| InChI | InChI=1S/C23H42O3/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21(5)15-16-22(25)23(26)17-24/h8,13-15,18-19,22-26H,6-7,9-12,16-17H2,1-5H3/t19?,22?,23-/m0/s1 |
| InChIKey | PJSNWUDEGROJHA-HXJXPZHGSA-N |
| XLogP | 5.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|