C30H52 — CID 21160005
(3E,5E,7E,9E)-2,6,10,15,19,23-hexamethyltetracosa-1,3,5,7,9-pentaene (PubChem CID 21160005) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (3E,5E,7E,9E)-2,6,10,15,19,23-hexamethyltetracosa-1,3,5,7,9-pentaene.
| Compound Name | (3E,5E,7E,9E)-2,6,10,15,19,23-hexamethyltetracosa-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 21160005 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (3E,5E,7E,9E)-2,6,10,15,19,23-hexamethyltetracosa-1,3,5,7,9-pentaene |
| SMILES | C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H52/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h11,13,15,19,21,23,26,28,30H,1,9-10,12,14,16-18,20,22,24H2,2-8H3/b15-11+,23-13+,27-21+,29-19+ |
| InChIKey | WYABICKDPBIOHS-KRFSUBJISA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|