C15H26 — CID 142155642
(3Z,5E)-2,6,11-trimethyldodeca-1,3,5-triene (PubChem CID 142155642) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (3Z,5E)-2,6,11-trimethyldodeca-1,3,5-triene.
| Compound Name | (3Z,5E)-2,6,11-trimethyldodeca-1,3,5-triene |
|---|---|
| PubChem CID | 142155642 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (3Z,5E)-2,6,11-trimethyldodeca-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C(/C)CCCCC(C)C |
| InChI | InChI=1S/C15H26/c1-13(2)9-6-7-11-15(5)12-8-10-14(3)4/h8,10,12-13H,3,6-7,9,11H2,1-2,4-5H3/b10-8-,15-12+ |
| InChIKey | YLVPKQYCQAGTKD-UADWGJSRSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|