C13H22 — CID 142166424
(7E,9Z)-2,7-dimethylundeca-1,7,9-triene (PubChem CID 142166424) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (7E,9Z)-2,7-dimethylundeca-1,7,9-triene.
| Compound Name | (7E,9Z)-2,7-dimethylundeca-1,7,9-triene |
|---|---|
| PubChem CID | 142166424 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (7E,9Z)-2,7-dimethylundeca-1,7,9-triene |
| SMILES | C=C(C)CCCC/C(C)=C/C=C\C |
| InChI | InChI=1S/C13H22/c1-5-6-10-13(4)11-8-7-9-12(2)3/h5-6,10H,2,7-9,11H2,1,3-4H3/b6-5-,13-10+ |
| InChIKey | FYWQQSQXZMNDID-UHYAQULISA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|