C14H26 — CID 143714794
(2Z,4E)-5,9-dimethyldodeca-2,4-diene (PubChem CID 143714794) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (2Z,4E)-5,9-dimethyldodeca-2,4-diene.
| Compound Name | (2Z,4E)-5,9-dimethyldodeca-2,4-diene |
|---|---|
| PubChem CID | 143714794 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (2Z,4E)-5,9-dimethyldodeca-2,4-diene |
| SMILES | C/C=C\C=C(/C)CCCC(C)CCC |
| InChI | InChI=1S/C14H26/c1-5-7-10-14(4)12-8-11-13(3)9-6-2/h5,7,10,13H,6,8-9,11-12H2,1-4H3/b7-5-,14-10+ |
| InChIKey | JPQVOTHSHXPWLA-JGYYRVNPSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|